C28H26N2O8 — CID 17272891
3-O'-methyl 5-O'-prop-2-enyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate (PubChem CID 17272891) has the molecular formula C28H26N2O8 and a molecular weight of 518.52 g/mol. Its IUPAC name is 3-O'-methyl 5-O'-prop-2-enyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate.
| Compound Name | 3-O'-methyl 5-O'-prop-2-enyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
|---|---|
| PubChem CID | 17272891 |
| Molecular Formula | C28H26N2O8 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 3-O'-methyl 5-O'-prop-2-enyl 2'-amino-6'-methyl-2-oxo-1-(2-oxo-2-phenylmethoxyethyl)spiro[indole-3,4'-pyran]-3',5'-dicarboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C(=O)OC)C12C(=O)N(CC(=O)OCc1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C28H26N2O8/c1-4-14-36-26(33)22-17(2)38-24(29)23(25(32)35-3)28(22)19-12-8-9-13-20(19)30(27(28)34)15-21(31)37-16-18-10-6-5-7-11-18/h4-13H,1,14-16,29H2,2-3H3 |
| InChIKey | RTTQDIZGWLROAJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|