About 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid
1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid (PubChem CID 165483402) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid.
Molecular Properties
| Compound Name | 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid |
| PubChem CID | 165483402 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid |
| SMILES | CCN1C(=O)C2(CC2C(=O)O)c2cc(C)ccc21 |
| InChI | InChI=1S/C14H15NO3/c1-3-15-11-5-4-8(2)6-9(11)14(13(15)18)7-10(14)12(16)17/h4-6,10H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | NFKBTFRBQBEKRW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid?
The IUPAC name of 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid (CID 165483402) is 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid.
What is the SMILES notation for 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid?
The canonical SMILES for 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid is CCN1C(=O)C2(CC2C(=O)O)c2cc(C)ccc21.
What is the InChIKey of 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid?
The InChIKey is NFKBTFRBQBEKRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c1-3-15-11-5-4-8(2)6-9(11)14(13(15)18)7-10(14)12(16)17/h4-6,10H,3,7H2,1-2H3,(H,16,17).
What are the key properties of 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid?
1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid has a molecular weight of 245.28 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-5'-methyl-2'-oxospiro[cyclopropane-2,3'-indole]-1-carboxylic acid is sourced from PubChem (CID 165483402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).