C16H23NO3 — CID 142193917
ethane;1-ethyl-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid (PubChem CID 142193917) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is ethane;1-ethyl-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid.
| Compound Name | ethane;1-ethyl-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid |
|---|---|
| PubChem CID | 142193917 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | ethane;1-ethyl-8-methyl-2-oxo-4,5-dihydro-3H-1-benzazepine-3-carboxylic acid |
| SMILES | CC.CCN1C(=O)C(C(=O)O)CCc2ccc(C)cc21 |
| InChI | InChI=1S/C14H17NO3.C2H6/c1-3-15-12-8-9(2)4-5-10(12)6-7-11(13(15)16)14(17)18;1-2/h4-5,8,11H,3,6-7H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | DYIWVDVEQKGGQW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|