C22H16N6O4S — CID 41079282
(3S)-6'-amino-3'-[(4-methylphenyl)sulfanylmethyl]-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-5'-carbonitrile (PubChem CID 41079282) has the molecular formula C22H16N6O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is (3S)-6'-amino-3'-[(4-methylphenyl)sulfanylmethyl]-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-5'-carbonitrile.
| Compound Name | (3S)-6'-amino-3'-[(4-methylphenyl)sulfanylmethyl]-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-5'-carbonitrile |
|---|---|
| PubChem CID | 41079282 |
| Molecular Formula | C22H16N6O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | (3S)-6'-amino-3'-[(4-methylphenyl)sulfanylmethyl]-5-nitro-2-oxospiro[1H-indole-3,4'-2H-pyrano[2,3-c]pyrazole]-5'-carbonitrile |
| SMILES | Cc1ccc(SCc2[nH]nc3c2[C@@]2(C(=O)Nc4ccc([N+](=O)[O-])cc42)C(C#N)=C(N)O3)cc1 |
| InChI | InChI=1S/C22H16N6O4S/c1-11-2-5-13(6-3-11)33-10-17-18-20(27-26-17)32-19(24)15(9-23)22(18)14-8-12(28(30)31)4-7-16(14)25-21(22)29/h2-8H,10,24H2,1H3,(H,25,29)(H,26,27)/t22-/m0/s1 |
| InChIKey | BXAXGSWYVQILJK-QFIPXVFZSA-N |
| XLogP | 3.24 |
| TPSA | 159.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|