C21H15N7O3 — CID 135621337
6'-amino-3'-methyl-1'-(4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-7H-pyrazolo[5,4-b]pyridine]-5'-carbonitrile (PubChem CID 135621337) has the molecular formula C21H15N7O3 and a molecular weight of 413.40 g/mol. Its IUPAC name is 6'-amino-3'-methyl-1'-(4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-7H-pyrazolo[5,4-b]pyridine]-5'-carbonitrile.
| Compound Name | 6'-amino-3'-methyl-1'-(4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-7H-pyrazolo[5,4-b]pyridine]-5'-carbonitrile |
|---|---|
| PubChem CID | 135621337 |
| Molecular Formula | C21H15N7O3 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 6'-amino-3'-methyl-1'-(4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-7H-pyrazolo[5,4-b]pyridine]-5'-carbonitrile |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c2c1C1(C(=O)Nc3ccccc31)C(C#N)=C(N)N2 |
| InChI | InChI=1S/C21H15N7O3/c1-11-17-19(27(26-11)12-6-8-13(9-7-12)28(30)31)25-18(23)15(10-22)21(17)14-4-2-3-5-16(14)24-20(21)29/h2-9,25H,23H2,1H3,(H,24,29) |
| InChIKey | ZUOKGJZPNUQJNB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 151.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|