C22H15N7O5 — CID 136776900
(3S)-6'-methyl-5-nitro-4'-phenylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione (PubChem CID 136776900) has the molecular formula C22H15N7O5 and a molecular weight of 457.41 g/mol. Its IUPAC name is (3S)-6'-methyl-5-nitro-4'-phenylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione.
| Compound Name | (3S)-6'-methyl-5-nitro-4'-phenylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione |
|---|---|
| PubChem CID | 136776900 |
| Molecular Formula | C22H15N7O5 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (3S)-6'-methyl-5-nitro-4'-phenylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione |
| SMILES | Cc1nn(-c2ccccc2)c2c1[C@]1(C(=O)Nc3ccc([N+](=O)[O-])cc31)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C22H15N7O5/c1-10-15-18(28(27-10)11-5-3-2-4-6-11)24-17-16(19(30)26-21(32)25-17)22(15)13-9-12(29(33)34)7-8-14(13)23-20(22)31/h2-9H,1H3,(H,23,31)(H3,24,25,26,30,32)/t22-/m0/s1 |
| InChIKey | APOWSIRNHVGRFB-QFIPXVFZSA-N |
| XLogP | 1.81 |
| TPSA | 167.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|