C16H10BrN5O4 — CID 136880064
5-bromo-6'-methylspiro[1H-indole-3,8'-4-oxa-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione (PubChem CID 136880064) has the molecular formula C16H10BrN5O4 and a molecular weight of 416.19 g/mol. Its IUPAC name is 5-bromo-6'-methylspiro[1H-indole-3,8'-4-oxa-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione.
| Compound Name | 5-bromo-6'-methylspiro[1H-indole-3,8'-4-oxa-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione |
|---|---|
| PubChem CID | 136880064 |
| Molecular Formula | C16H10BrN5O4 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 5-bromo-6'-methylspiro[1H-indole-3,8'-4-oxa-2,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3(7),5-triene]-2,10',12'-trione |
| SMILES | Cc1noc2c1C1(C(=O)Nc3ccc(Br)cc31)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C16H10BrN5O4/c1-5-9-13(26-22-5)19-11-10(12(23)21-15(25)20-11)16(9)7-4-6(17)2-3-8(7)18-14(16)24/h2-4H,1H3,(H,18,24)(H3,19,20,21,23,25) |
| InChIKey | PINOHGFYVYPMHD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |