C16H11ClN6O3 — CID 137317856
7-chloro-6'-methylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene]-2,10',12'-trione (PubChem CID 137317856) has the molecular formula C16H11ClN6O3 and a molecular weight of 370.76 g/mol. Its IUPAC name is 7-chloro-6'-methylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene]-2,10',12'-trione.
| Compound Name | 7-chloro-6'-methylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene]-2,10',12'-trione |
|---|---|
| PubChem CID | 137317856 |
| Molecular Formula | C16H11ClN6O3 |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 7-chloro-6'-methylspiro[1H-indole-3,8'-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene]-2,10',12'-trione |
| SMILES | Cc1[nH]nc2c1C1(C(=O)Nc3c(Cl)cccc31)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C16H11ClN6O3/c1-5-8-12(23-22-5)19-11-9(13(24)21-15(26)20-11)16(8)6-3-2-4-7(17)10(6)18-14(16)25/h2-4H,1H3,(H,18,25)(H4,19,20,21,22,23,24,26) |
| InChIKey | SAHDYZZPIMNFBV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 135.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |