C15H12ClN5O2 — CID 135898236
(8S)-8-(4-chlorophenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione (PubChem CID 135898236) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is (8S)-8-(4-chlorophenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione.
| Compound Name | (8S)-8-(4-chlorophenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135898236 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (8S)-8-(4-chlorophenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
| SMILES | Cc1[nH]nc2c1[C@H](c1ccc(Cl)cc1)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C15H12ClN5O2/c1-6-9-10(7-2-4-8(16)5-3-7)11-12(17-13(9)21-20-6)18-15(23)19-14(11)22/h2-5,10H,1H3,(H4,17,18,19,20,21,22,23)/t10-/m0/s1 |
| InChIKey | GLYRGUWRAQGRSG-JTQLQIEISA-N |
| XLogP | 1.99 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |