C21H18ClN3O2 — CID 135646151
4-(4-chlorophenyl)-7-(furan-2-yl)-3-methyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 135646151) has the molecular formula C21H18ClN3O2 and a molecular weight of 379.85 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-7-(furan-2-yl)-3-methyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 4-(4-chlorophenyl)-7-(furan-2-yl)-3-methyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135646151 |
| Molecular Formula | C21H18ClN3O2 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-(4-chlorophenyl)-7-(furan-2-yl)-3-methyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1[nH]nc2c1C(c1ccc(Cl)cc1)C1=C(CC(c3ccco3)CC1=O)N2 |
| InChI | InChI=1S/C21H18ClN3O2/c1-11-18-19(12-4-6-14(22)7-5-12)20-15(23-21(18)25-24-11)9-13(10-16(20)26)17-3-2-8-27-17/h2-8,13,19H,9-10H2,1H3,(H2,23,24,25) |
| InChIKey | XRPWLXJJNIIMPS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |