C22H17N3O6 — CID 27881692
4-[(5R,8S)-8-(furan-2-yl)-2,4,6-trioxo-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoic acid (PubChem CID 27881692) has the molecular formula C22H17N3O6 and a molecular weight of 419.39 g/mol. Its IUPAC name is 4-[(5R,8S)-8-(furan-2-yl)-2,4,6-trioxo-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoic acid.
| Compound Name | 4-[(5R,8S)-8-(furan-2-yl)-2,4,6-trioxo-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoic acid |
|---|---|
| PubChem CID | 27881692 |
| Molecular Formula | C22H17N3O6 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 4-[(5R,8S)-8-(furan-2-yl)-2,4,6-trioxo-1,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzoic acid |
| SMILES | O=C1C[C@@H](c2ccco2)CC2=C1[C@@H](c1ccc(C(=O)O)cc1)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C22H17N3O6/c26-14-9-12(15-2-1-7-31-15)8-13-17(14)16(10-3-5-11(6-4-10)21(28)29)18-19(23-13)24-22(30)25-20(18)27/h1-7,12,16H,8-9H2,(H,28,29)(H3,23,24,25,27,30)/t12-,16+/m0/s1 |
| InChIKey | DOXRGRFTMPVVJG-BLLLJJGKSA-N |
| XLogP | 2.31 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |