C19H17N3O3S — CID 27881986
(4R,7R)-7-(furan-2-yl)-4-(5-methylthiophen-2-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 27881986) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is (4R,7R)-7-(furan-2-yl)-4-(5-methylthiophen-2-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R,7R)-7-(furan-2-yl)-4-(5-methylthiophen-2-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 27881986 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (4R,7R)-7-(furan-2-yl)-4-(5-methylthiophen-2-yl)-2,4,6,7,8,9-hexahydro-1H-pyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | Cc1ccc([C@@H]2C3=C(C[C@@H](c4ccco4)CC3=O)Nc3[nH][nH]c(=O)c32)s1 |
| InChI | InChI=1S/C19H17N3O3S/c1-9-4-5-14(26-9)16-15-11(20-18-17(16)19(24)22-21-18)7-10(8-12(15)23)13-3-2-6-25-13/h2-6,10,16H,7-8H2,1H3,(H3,20,21,22,24)/t10-,16-/m1/s1 |
| InChIKey | CFXVDCWPURRYCX-QLJPJBMISA-N |
| XLogP | 3.62 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |