C23H21N3O4S — CID 135914099
2-[4-[(4R,7S)-3-methyl-5-oxo-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]phenoxy]acetic acid (PubChem CID 135914099) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[4-[(4R,7S)-3-methyl-5-oxo-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(4R,7S)-3-methyl-5-oxo-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135914099 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 2-[4-[(4R,7S)-3-methyl-5-oxo-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-4-yl]phenoxy]acetic acid |
| SMILES | Cc1[nH]nc2c1[C@@H](c1ccc(OCC(=O)O)cc1)C1=C(C[C@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C23H21N3O4S/c1-12-20-21(13-4-6-15(7-5-13)30-11-19(28)29)22-16(24-23(20)26-25-12)9-14(10-17(22)27)18-3-2-8-31-18/h2-8,14,21H,9-11H2,1H3,(H,28,29)(H2,24,25,26)/t14-,21+/m0/s1 |
| InChIKey | PGNQMTDTFXWNTR-LHSJRXKWSA-N |
| XLogP | 4.20 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |