C20H19N3OS2 — CID 135914183
(4R,7R)-3-methyl-4-(3-methylthiophen-2-yl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 135914183) has the molecular formula C20H19N3OS2 and a molecular weight of 381.53 g/mol. Its IUPAC name is (4R,7R)-3-methyl-4-(3-methylthiophen-2-yl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | (4R,7R)-3-methyl-4-(3-methylthiophen-2-yl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135914183 |
| Molecular Formula | C20H19N3OS2 |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (4R,7R)-3-methyl-4-(3-methylthiophen-2-yl)-7-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1ccsc1[C@H]1C2=C(C[C@@H](c3cccs3)CC2=O)Nc2n[nH]c(C)c21 |
| InChI | InChI=1S/C20H19N3OS2/c1-10-5-7-26-19(10)18-16-11(2)22-23-20(16)21-13-8-12(9-14(24)17(13)18)15-4-3-6-25-15/h3-7,12,18H,8-9H2,1-2H3,(H2,21,22,23)/t12-,18-/m1/s1 |
| InChIKey | VAZIIDINXXEBRI-KZULUSFZSA-N |
| XLogP | 5.11 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |