C21H19N3OS — CID 136833708
(4R)-3-(4-methylphenyl)-4-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 136833708) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is (4R)-3-(4-methylphenyl)-4-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | (4R)-3-(4-methylphenyl)-4-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136833708 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (4R)-3-(4-methylphenyl)-4-thiophen-2-yl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1ccc(-c2[nH]nc3c2[C@@H](c2cccs2)C2=C(CCCC2=O)N3)cc1 |
| InChI | InChI=1S/C21H19N3OS/c1-12-7-9-13(10-8-12)20-19-18(16-6-3-11-26-16)17-14(4-2-5-15(17)25)22-21(19)24-23-20/h3,6-11,18H,2,4-5H2,1H3,(H2,22,23,24)/t18-/m0/s1 |
| InChIKey | AERJZEUWSONBGI-SFHVURJKSA-N |
| XLogP | 5.01 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |