C23H23N3OS — CID 136833710
(4R)-7,7-dimethyl-3-(4-methylphenyl)-4-thiophen-2-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (PubChem CID 136833710) has the molecular formula C23H23N3OS and a molecular weight of 389.52 g/mol. Its IUPAC name is (4R)-7,7-dimethyl-3-(4-methylphenyl)-4-thiophen-2-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one.
| Compound Name | (4R)-7,7-dimethyl-3-(4-methylphenyl)-4-thiophen-2-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136833710 |
| Molecular Formula | C23H23N3OS |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (4R)-7,7-dimethyl-3-(4-methylphenyl)-4-thiophen-2-yl-4,6,8,9-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1ccc(-c2[nH]nc3c2[C@@H](c2cccs2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C23H23N3OS/c1-13-6-8-14(9-7-13)21-20-19(17-5-4-10-28-17)18-15(24-22(20)26-25-21)11-23(2,3)12-16(18)27/h4-10,19H,11-12H2,1-3H3,(H2,24,25,26)/t19-/m0/s1 |
| InChIKey | NPNALXJWNLIHDT-IBGZPJMESA-N |
| XLogP | 5.65 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |