C25H25N3O2S2 — CID 135535210
8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5-thiophen-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135535210) has the molecular formula C25H25N3O2S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5-thiophen-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5-thiophen-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135535210 |
| Molecular Formula | C25H25N3O2S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5-thiophen-2-yl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccc(CSc2nc3c(c(=O)[nH]2)C(c2cccs2)C2=C(CC(C)(C)CC2=O)N3)cc1 |
| InChI | InChI=1S/C25H25N3O2S2/c1-14-6-8-15(9-7-14)13-32-24-27-22-21(23(30)28-24)20(18-5-4-10-31-18)19-16(26-22)11-25(2,3)12-17(19)29/h4-10,20H,11-13H2,1-3H3,(H2,26,27,28,30) |
| InChIKey | YUXGWEMJKWYGDD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |