C28H28IN3O4S — CID 135535227
5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135535227) has the molecular formula C28H28IN3O4S and a molecular weight of 629.52 g/mol. Its IUPAC name is 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135535227 |
| Molecular Formula | C28H28IN3O4S |
| Molecular Weight | 629.52 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(C)cc4)[nH]c(=O)c32)cc(I)c1O |
| InChI | InChI=1S/C28H28IN3O4S/c1-14-5-7-15(8-6-14)13-37-27-31-25-23(26(35)32-27)21(16-9-17(29)24(34)20(10-16)36-4)22-18(30-25)11-28(2,3)12-19(22)33/h5-10,21,34H,11-13H2,1-4H3,(H2,30,31,32,35) |
| InChIKey | GANOVZPYTDREIJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|