C29H30FN3O5S — CID 135712325
2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(3,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135712325) has the molecular formula C29H30FN3O5S and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(3,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(3,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135712325 |
| Molecular Formula | C29H30FN3O5S |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-(3,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(F)cc4)[nH]c(=O)c32)cc(OC)c1OC |
| InChI | InChI=1S/C29H30FN3O5S/c1-29(2)12-18-23(19(34)13-29)22(16-10-20(36-3)25(38-5)21(11-16)37-4)24-26(31-18)32-28(33-27(24)35)39-14-15-6-8-17(30)9-7-15/h6-11,22H,12-14H2,1-5H3,(H2,31,32,33,35) |
| InChIKey | HCDCHIJHVKOFSG-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |