C28H27ClFN3O4S — CID 135656726
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(2,3-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135656726) has the molecular formula C28H27ClFN3O4S and a molecular weight of 556.06 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(2,3-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(2,3-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135656726 |
| Molecular Formula | C28H27ClFN3O4S |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-5-(2,3-dimethoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(F)cc4Cl)[nH]c(=O)c32)c1OC |
| InChI | InChI=1S/C28H27ClFN3O4S/c1-28(2)11-18-22(19(34)12-28)21(16-6-5-7-20(36-3)24(16)37-4)23-25(31-18)32-27(33-26(23)35)38-13-14-8-9-15(30)10-17(14)29/h5-10,21H,11-13H2,1-4H3,(H2,31,32,33,35) |
| InChIKey | NYXUMAQPFUXCEG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |