C26H23ClFN3O2S — CID 135572462
2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-phenyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135572462) has the molecular formula C26H23ClFN3O2S and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-phenyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-phenyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135572462 |
| Molecular Formula | C26H23ClFN3O2S |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 2-[(2-chloro-4-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5-phenyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Nc1nc(SCc3ccc(F)cc3Cl)[nH]c(=O)c1C2c1ccccc1 |
| InChI | InChI=1S/C26H23ClFN3O2S/c1-26(2)11-18-21(19(32)12-26)20(14-6-4-3-5-7-14)22-23(29-18)30-25(31-24(22)33)34-13-15-8-9-16(28)10-17(15)27/h3-10,20H,11-13H2,1-2H3,(H2,29,30,31,33) |
| InChIKey | HDKROKZZQSZRCC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |