C29H31N3O4S — CID 135535208
5-(2,3-dimethoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135535208) has the molecular formula C29H31N3O4S and a molecular weight of 517.65 g/mol. Its IUPAC name is 5-(2,3-dimethoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(2,3-dimethoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135535208 |
| Molecular Formula | C29H31N3O4S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 5-(2,3-dimethoxyphenyl)-8,8-dimethyl-2-[(4-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(C)cc4)[nH]c(=O)c32)c1OC |
| InChI | InChI=1S/C29H31N3O4S/c1-16-9-11-17(12-10-16)15-37-28-31-26-24(27(34)32-28)22(18-7-6-8-21(35-4)25(18)36-5)23-19(30-26)13-29(2,3)14-20(23)33/h6-12,22H,13-15H2,1-5H3,(H2,30,31,32,34) |
| InChIKey | IAEIXKITGIPBRG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |