C29H30N4O7S — CID 135417519
8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5-(2,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135417519) has the molecular formula C29H30N4O7S and a molecular weight of 578.65 g/mol. Its IUPAC name is 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5-(2,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5-(2,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135417519 |
| Molecular Formula | C29H30N4O7S |
| Molecular Weight | 578.65 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | 8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5-(2,4,5-trimethoxyphenyl)-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cc(OC)c(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc([N+](=O)[O-])cc4)[nH]c(=O)c32)cc1OC |
| InChI | InChI=1S/C29H30N4O7S/c1-29(2)12-18-24(19(34)13-29)23(17-10-21(39-4)22(40-5)11-20(17)38-3)25-26(30-18)31-28(32-27(25)35)41-14-15-6-8-16(9-7-15)33(36)37/h6-11,23H,12-14H2,1-5H3,(H2,30,31,32,35) |
| InChIKey | LMLZKNCZKAWPOR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.65 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|