C27H26N4O5S — CID 135935361
(5S)-5-(3-methoxyphenyl)-8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135935361) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is (5S)-5-(3-methoxyphenyl)-8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5S)-5-(3-methoxyphenyl)-8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135935361 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (5S)-5-(3-methoxyphenyl)-8,8-dimethyl-2-[(4-nitrophenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1cccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc([N+](=O)[O-])cc4)[nH]c(=O)c32)c1 |
| InChI | InChI=1S/C27H26N4O5S/c1-27(2)12-19-22(20(32)13-27)21(16-5-4-6-18(11-16)36-3)23-24(28-19)29-26(30-25(23)33)37-14-15-7-9-17(10-8-15)31(34)35/h4-11,21H,12-14H2,1-3H3,(H2,28,29,30,33)/t21-/m0/s1 |
| InChIKey | YLVVPIASAKMSIF-NRFANRHFSA-N |
| XLogP | 5.18 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|