C30H33N3O4S — CID 136761923
(5R)-5-(3,4-dimethoxyphenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136761923) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is (5R)-5-(3,4-dimethoxyphenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-5-(3,4-dimethoxyphenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136761923 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | (5R)-5-(3,4-dimethoxyphenyl)-2-[(2,4-dimethylphenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | COc1ccc([C@@H]2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccc(C)cc4C)[nH]c(=O)c32)cc1OC |
| InChI | InChI=1S/C30H33N3O4S/c1-16-7-8-19(17(2)11-16)15-38-29-32-27-26(28(35)33-29)24(18-9-10-22(36-5)23(12-18)37-6)25-20(31-27)13-30(3,4)14-21(25)34/h7-12,24H,13-15H2,1-6H3,(H2,31,32,33,35)/t24-/m1/s1 |
| InChIKey | OWWPQBFKBXNUOQ-XMMPIXPASA-N |
| XLogP | 5.90 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |