C27H26BrN3O2S — CID 136714256
(5S)-5-(4-bromophenyl)-8,8-dimethyl-2-[(2-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 136714256) has the molecular formula C27H26BrN3O2S and a molecular weight of 536.50 g/mol. Its IUPAC name is (5S)-5-(4-bromophenyl)-8,8-dimethyl-2-[(2-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5S)-5-(4-bromophenyl)-8,8-dimethyl-2-[(2-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 136714256 |
| Molecular Formula | C27H26BrN3O2S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (5S)-5-(4-bromophenyl)-8,8-dimethyl-2-[(2-methylphenyl)methylsulfanyl]-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | Cc1ccccc1CSc1nc2c(c(=O)[nH]1)[C@@H](c1ccc(Br)cc1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C27H26BrN3O2S/c1-15-6-4-5-7-17(15)14-34-26-30-24-23(25(33)31-26)21(16-8-10-18(28)11-9-16)22-19(29-24)12-27(2,3)13-20(22)32/h4-11,21H,12-14H2,1-3H3,(H2,29,30,31,33)/t21-/m0/s1 |
| InChIKey | ZMTVQRNKRGQVJG-NRFANRHFSA-N |
| XLogP | 6.33 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |