C30H33FN4O2S — CID 135507083
5-[4-(diethylamino)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135507083) has the molecular formula C30H33FN4O2S and a molecular weight of 532.69 g/mol. Its IUPAC name is 5-[4-(diethylamino)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-[4-(diethylamino)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135507083 |
| Molecular Formula | C30H33FN4O2S |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 5-[4-(diethylamino)phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCN(CC)c1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3nc(SCc4ccccc4F)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C30H33FN4O2S/c1-5-35(6-2)20-13-11-18(12-14-20)24-25-22(15-30(3,4)16-23(25)36)32-27-26(24)28(37)34-29(33-27)38-17-19-9-7-8-10-21(19)31/h7-14,24H,5-6,15-17H2,1-4H3,(H2,32,33,34,37) |
| InChIKey | QJFLMCNYTQPTJC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |