C24H29N3O4S — CID 135405644
2-butylsulfanyl-5-(4-hydroxy-3-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135405644) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is 2-butylsulfanyl-5-(4-hydroxy-3-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 2-butylsulfanyl-5-(4-hydroxy-3-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135405644 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 2-butylsulfanyl-5-(4-hydroxy-3-methoxyphenyl)-8,8-dimethyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCCCSc1nc2c(c(=O)[nH]1)C(c1ccc(O)c(OC)c1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C24H29N3O4S/c1-5-6-9-32-23-26-21-20(22(30)27-23)18(13-7-8-15(28)17(10-13)31-4)19-14(25-21)11-24(2,3)12-16(19)29/h7-8,10,18,28H,5-6,9,11-12H2,1-4H3,(H2,25,26,27,30) |
| InChIKey | RLANDJRQBXLNJS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|