C23H26IN3O4S — CID 135535178
5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-propylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135535178) has the molecular formula C23H26IN3O4S and a molecular weight of 567.45 g/mol. Its IUPAC name is 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-propylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-propylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135535178 |
| Molecular Formula | C23H26IN3O4S |
| Molecular Weight | 567.45 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 5-(4-hydroxy-3-iodo-5-methoxyphenyl)-8,8-dimethyl-2-propylsulfanyl-5,7,9,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCCSc1nc2c(c(=O)[nH]1)C(c1cc(I)c(O)c(OC)c1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C23H26IN3O4S/c1-5-6-32-22-26-20-18(21(30)27-22)16(11-7-12(24)19(29)15(8-11)31-4)17-13(25-20)9-23(2,3)10-14(17)28/h7-8,16,29H,5-6,9-10H2,1-4H3,(H2,25,26,27,30) |
| InChIKey | IRLDBDCZBAYJLP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|