C23H21N3O — CID 135833495
4-(4-methylphenyl)-3-phenyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 135833495) has the molecular formula C23H21N3O and a molecular weight of 355.44 g/mol. Its IUPAC name is 4-(4-methylphenyl)-3-phenyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 4-(4-methylphenyl)-3-phenyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 135833495 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 4-(4-methylphenyl)-3-phenyl-2,4,6,7,8,9-hexahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1ccc(C2C3=C(CCCC3=O)Nc3n[nH]c(-c4ccccc4)c32)cc1 |
| InChI | InChI=1S/C23H21N3O/c1-14-10-12-15(13-11-14)19-20-17(8-5-9-18(20)27)24-23-21(19)22(25-26-23)16-6-3-2-4-7-16/h2-4,6-7,10-13,19H,5,8-9H2,1H3,(H2,24,25,26) |
| InChIKey | JNUUAJLHSLNTMZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |