C23H21NO3S2 — CID 42549449
(3S,9S)-6,7-dimethoxy-3,9-dithiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one (PubChem CID 42549449) has the molecular formula C23H21NO3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is (3S,9S)-6,7-dimethoxy-3,9-dithiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one.
| Compound Name | (3S,9S)-6,7-dimethoxy-3,9-dithiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 42549449 |
| Molecular Formula | C23H21NO3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | (3S,9S)-6,7-dimethoxy-3,9-dithiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@H](c1cccs1)C1=C(C[C@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C23H21NO3S2/c1-26-18-11-14-15(12-19(18)27-2)24-16-9-13(20-5-3-7-28-20)10-17(25)23(16)22(14)21-6-4-8-29-21/h3-8,11-13,22,24H,9-10H2,1-2H3/t13-,22+/m0/s1 |
| InChIKey | KTMQQZJAFFZPNS-WHEQGISXSA-N |
| XLogP | 5.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |