C25H21Cl2NO3S — CID 27881346
(3R,9S)-9-(3,4-dichlorophenyl)-6,7-dimethoxy-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one (PubChem CID 27881346) has the molecular formula C25H21Cl2NO3S and a molecular weight of 486.42 g/mol. Its IUPAC name is (3R,9S)-9-(3,4-dichlorophenyl)-6,7-dimethoxy-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one.
| Compound Name | (3R,9S)-9-(3,4-dichlorophenyl)-6,7-dimethoxy-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 27881346 |
| Molecular Formula | C25H21Cl2NO3S |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | (3R,9S)-9-(3,4-dichlorophenyl)-6,7-dimethoxy-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc(Cl)c(Cl)c1)C1=C(C[C@@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C25H21Cl2NO3S/c1-30-21-11-15-18(12-22(21)31-2)28-19-9-14(23-4-3-7-32-23)10-20(29)25(19)24(15)13-5-6-16(26)17(27)8-13/h3-8,11-12,14,24,28H,9-10H2,1-2H3/t14-,24+/m1/s1 |
| InChIKey | MSWVFGPDFHZQBV-SHACYNPGSA-N |
| XLogP | 7.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |