C25H22N2O5S — CID 27881381
(3S,9R)-6,7-dimethoxy-9-(4-nitrophenyl)-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one (PubChem CID 27881381) has the molecular formula C25H22N2O5S and a molecular weight of 462.53 g/mol. Its IUPAC name is (3S,9R)-6,7-dimethoxy-9-(4-nitrophenyl)-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one.
| Compound Name | (3S,9R)-6,7-dimethoxy-9-(4-nitrophenyl)-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
|---|---|
| PubChem CID | 27881381 |
| Molecular Formula | C25H22N2O5S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | (3S,9R)-6,7-dimethoxy-9-(4-nitrophenyl)-3-thiophen-2-yl-3,4,9,10-tetrahydro-2H-acridin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@@H](c1ccc([N+](=O)[O-])cc1)C1=C(C[C@H](c3cccs3)CC1=O)N2 |
| InChI | InChI=1S/C25H22N2O5S/c1-31-21-12-17-18(13-22(21)32-2)26-19-10-15(23-4-3-9-33-23)11-20(28)25(19)24(17)14-5-7-16(8-6-14)27(29)30/h3-9,12-13,15,24,26H,10-11H2,1-2H3/t15-,24+/m0/s1 |
| InChIKey | GYOSDWNUWCOOTD-IZHWHUGBSA-N |
| XLogP | 5.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|