C21H18N4O4S — CID 135646096
2-[4-(8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)phenoxy]acetic acid (PubChem CID 135646096) has the molecular formula C21H18N4O4S and a molecular weight of 422.47 g/mol. Its IUPAC name is 2-[4-(8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)phenoxy]acetic acid.
| Compound Name | 2-[4-(8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 135646096 |
| Molecular Formula | C21H18N4O4S |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[4-(8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C2C3=C(CC(c4cccs4)CC3=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C21H18N4O4S/c26-16-9-13(17-2-1-7-30-17)8-15-19(16)20(25-21(24-15)22-11-23-25)12-3-5-14(6-4-12)29-10-18(27)28/h1-7,11,13,20H,8-10H2,(H,27,28)(H,22,23,24) |
| InChIKey | IVDZIJNCZKDLAM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |