C27H24N4O3S — CID 135646159
9-(3-methoxy-4-phenylmethoxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135646159) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is 9-(3-methoxy-4-phenylmethoxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3-methoxy-4-phenylmethoxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135646159 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 9-(3-methoxy-4-phenylmethoxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc(C2C3=C(CC(c4cccs4)CC3=O)Nc3ncnn32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N4O3S/c1-33-23-14-18(9-10-22(23)34-15-17-6-3-2-4-7-17)26-25-20(30-27-28-16-29-31(26)27)12-19(13-21(25)32)24-8-5-11-35-24/h2-11,14,16,19,26H,12-13,15H2,1H3,(H,28,29,30) |
| InChIKey | HUPDMEGEXFQICO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |