C20H17N5O5S — CID 135913418
(6S,9R)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135913418) has the molecular formula C20H17N5O5S and a molecular weight of 439.45 g/mol. Its IUPAC name is (6S,9R)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6S,9R)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135913418 |
| Molecular Formula | C20H17N5O5S |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | (6S,9R)-9-(4-hydroxy-3-methoxy-5-nitrophenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1cc([C@@H]2C3=C(C[C@H](c4cccs4)CC3=O)Nc3ncnn32)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C20H17N5O5S/c1-30-15-8-11(6-13(19(15)27)25(28)29)18-17-12(23-20-21-9-22-24(18)20)5-10(7-14(17)26)16-3-2-4-31-16/h2-4,6,8-10,18,27H,5,7H2,1H3,(H,21,22,23)/t10-,18+/m0/s1 |
| InChIKey | AJONZHVWKWGNKI-XTZNXHDOSA-N |
| XLogP | 3.38 |
| TPSA | 132.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|