C19H16N4O3S — CID 135913409
(6R,9S)-9-(3,4-dihydroxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135913409) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is (6R,9S)-9-(3,4-dihydroxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-9-(3,4-dihydroxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135913409 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | (6R,9S)-9-(3,4-dihydroxyphenyl)-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1C[C@H](c2cccs2)CC2=C1[C@H](c1ccc(O)c(O)c1)n1ncnc1N2 |
| InChI | InChI=1S/C19H16N4O3S/c24-13-4-3-10(7-14(13)25)18-17-12(22-19-20-9-21-23(18)19)6-11(8-15(17)26)16-2-1-5-27-16/h1-5,7,9,11,18,24-25H,6,8H2,(H,20,21,22)/t11-,18+/m1/s1 |
| InChIKey | ODYPFVJSPDUUCM-ZMZPIMSZSA-N |
| XLogP | 3.17 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|