C20H16N4O3S — CID 135913323
2-[(6S,9S)-8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl]benzoic acid (PubChem CID 135913323) has the molecular formula C20H16N4O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[(6S,9S)-8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl]benzoic acid.
| Compound Name | 2-[(6S,9S)-8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl]benzoic acid |
|---|---|
| PubChem CID | 135913323 |
| Molecular Formula | C20H16N4O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 2-[(6S,9S)-8-oxo-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-9-yl]benzoic acid |
| SMILES | O=C1C[C@@H](c2cccs2)CC2=C1[C@H](c1ccccc1C(=O)O)n1ncnc1N2 |
| InChI | InChI=1S/C20H16N4O3S/c25-15-9-11(16-6-3-7-28-16)8-14-17(15)18(24-20(23-14)21-10-22-24)12-4-1-2-5-13(12)19(26)27/h1-7,10-11,18H,8-9H2,(H,26,27)(H,21,22,23)/t11-,18-/m0/s1 |
| InChIKey | XGTBKDMGDFDMNO-VOJFVSQTSA-N |
| XLogP | 3.45 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |