C23H18N4OS — CID 135611458
(6R,9S)-9-naphthalen-1-yl-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135611458) has the molecular formula C23H18N4OS and a molecular weight of 398.49 g/mol. Its IUPAC name is (6R,9S)-9-naphthalen-1-yl-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-9-naphthalen-1-yl-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135611458 |
| Molecular Formula | C23H18N4OS |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (6R,9S)-9-naphthalen-1-yl-6-thiophen-2-yl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1C[C@H](c2cccs2)CC2=C1[C@H](c1cccc3ccccc13)n1ncnc1N2 |
| InChI | InChI=1S/C23H18N4OS/c28-19-12-15(20-9-4-10-29-20)11-18-21(19)22(27-23(26-18)24-13-25-27)17-8-3-6-14-5-1-2-7-16(14)17/h1-10,13,15,22H,11-12H2,(H,24,25,26)/t15-,22+/m1/s1 |
| InChIKey | RYAXZGMQPYUCFF-QRQCRPRQSA-N |
| XLogP | 4.91 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |