C31H30N4O5 — CID 136852540
(6R,9S)-6-(3,4-dimethoxyphenyl)-9-(3-methoxy-4-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 136852540) has the molecular formula C31H30N4O5 and a molecular weight of 538.60 g/mol. Its IUPAC name is (6R,9S)-6-(3,4-dimethoxyphenyl)-9-(3-methoxy-4-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-6-(3,4-dimethoxyphenyl)-9-(3-methoxy-4-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 136852540 |
| Molecular Formula | C31H30N4O5 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (6R,9S)-6-(3,4-dimethoxyphenyl)-9-(3-methoxy-4-phenylmethoxyphenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | COc1ccc([C@H]2CC(=O)C3=C(C2)Nc2ncnn2[C@H]3c2ccc(OCc3ccccc3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C31H30N4O5/c1-37-25-11-9-20(15-27(25)38-2)22-13-23-29(24(36)14-22)30(35-31(34-23)32-18-33-35)21-10-12-26(28(16-21)39-3)40-17-19-7-5-4-6-8-19/h4-12,15-16,18,22,30H,13-14,17H2,1-3H3,(H,32,33,34)/t22-,30+/m1/s1 |
| InChIKey | XWLNMAHALBTTON-RCRUUEGKSA-N |
| XLogP | 5.30 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |