C15H13Cl2N5 — CID 137178184
8-(2,4-dichlorophenyl)-6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene (PubChem CID 137178184) has the molecular formula C15H13Cl2N5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene.
| Compound Name | 8-(2,4-dichlorophenyl)-6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
|---|---|
| PubChem CID | 137178184 |
| Molecular Formula | C15H13Cl2N5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
| SMILES | Cc1[nH]nc2c1C(c1ccc(Cl)cc1Cl)c1c(n[nH]c1C)N2 |
| InChI | InChI=1S/C15H13Cl2N5/c1-6-11-13(9-4-3-8(16)5-10(9)17)12-7(2)20-22-15(12)18-14(11)21-19-6/h3-5,13H,1-2H3,(H3,18,19,20,21,22) |
| InChIKey | PRQHAQPFYQFUPG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |