C15H15N5O2 — CID 137295266
4-(6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-8-yl)benzene-1,3-diol (PubChem CID 137295266) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 4-(6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-8-yl)benzene-1,3-diol.
| Compound Name | 4-(6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-8-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 137295266 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-(6,10-dimethyl-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraen-8-yl)benzene-1,3-diol |
| SMILES | Cc1[nH]nc2c1C(c1ccc(O)cc1O)c1c(n[nH]c1C)N2 |
| InChI | InChI=1S/C15H15N5O2/c1-6-11-13(9-4-3-8(21)5-10(9)22)12-7(2)18-20-15(12)16-14(11)19-17-6/h3-5,13,21-22H,1-2H3,(H3,16,17,18,19,20) |
| InChIKey | UBMWOSKAIOSHEW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |