C16H17N5 — CID 137193910
6,10-dimethyl-8-(4-methylphenyl)-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene (PubChem CID 137193910) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 6,10-dimethyl-8-(4-methylphenyl)-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene.
| Compound Name | 6,10-dimethyl-8-(4-methylphenyl)-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
|---|---|
| PubChem CID | 137193910 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 6,10-dimethyl-8-(4-methylphenyl)-2,4,5,11,12-pentazatricyclo[7.3.0.03,7]dodeca-1(12),3,6,9-tetraene |
| SMILES | Cc1ccc(C2c3c(n[nH]c3C)Nc3n[nH]c(C)c32)cc1 |
| InChI | InChI=1S/C16H17N5/c1-8-4-6-11(7-5-8)14-12-9(2)18-20-15(12)17-16-13(14)10(3)19-21-16/h4-7,14H,1-3H3,(H3,17,18,19,20,21) |
| InChIKey | SMKRHPXRAHQQIZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |