C16H13N3O4 — CID 135930082
4-[(8R)-6-methyl-10-oxo-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-8-yl]benzoic acid (PubChem CID 135930082) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-[(8R)-6-methyl-10-oxo-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-8-yl]benzoic acid.
| Compound Name | 4-[(8R)-6-methyl-10-oxo-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-8-yl]benzoic acid |
|---|---|
| PubChem CID | 135930082 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-[(8R)-6-methyl-10-oxo-11-oxa-2,4,5-triazatricyclo[7.3.0.03,7]dodeca-1(9),3,6-trien-8-yl]benzoic acid |
| SMILES | Cc1[nH]nc2c1[C@@H](c1ccc(C(=O)O)cc1)C1=C(COC1=O)N2 |
| InChI | InChI=1S/C16H13N3O4/c1-7-11-12(8-2-4-9(5-3-8)15(20)21)13-10(6-23-16(13)22)17-14(11)19-18-7/h2-5,12H,6H2,1H3,(H,20,21)(H2,17,18,19)/t12-/m1/s1 |
| InChIKey | YIPNHGQQIFEKJP-GFCCVEGCSA-N |
| XLogP | 1.78 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |