C17H17N5O3 — CID 135634048
8-(3-hydroxyphenyl)-6,11,13-trimethyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione (PubChem CID 135634048) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 8-(3-hydroxyphenyl)-6,11,13-trimethyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione.
| Compound Name | 8-(3-hydroxyphenyl)-6,11,13-trimethyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135634048 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 8-(3-hydroxyphenyl)-6,11,13-trimethyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
| SMILES | Cc1[nH]nc2c1C(c1cccc(O)c1)c1c(n(C)c(=O)n(C)c1=O)N2 |
| InChI | InChI=1S/C17H17N5O3/c1-8-11-12(9-5-4-6-10(23)7-9)13-15(18-14(11)20-19-8)21(2)17(25)22(3)16(13)24/h4-7,12,23H,1-3H3,(H2,18,19,20) |
| InChIKey | HLXIQYZKOAGGPV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |