C15H13N5O3 — CID 135634419
8-(3-hydroxyphenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione (PubChem CID 135634419) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 8-(3-hydroxyphenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione.
| Compound Name | 8-(3-hydroxyphenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
|---|---|
| PubChem CID | 135634419 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 8-(3-hydroxyphenyl)-6-methyl-2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
| SMILES | Cc1[nH]nc2c1C(c1cccc(O)c1)c1c([nH]c(=O)[nH]c1=O)N2 |
| InChI | InChI=1S/C15H13N5O3/c1-6-9-10(7-3-2-4-8(21)5-7)11-12(16-13(9)20-19-6)17-15(23)18-14(11)22/h2-5,10,21H,1H3,(H4,16,17,18,19,20,22,23) |
| InChIKey | OKKQPDFOPZPTJY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |