C9H8Cl2O3S — CID 117063408
2-(2,4-dichlorophenyl)-3-methylsulfonyloxirane (PubChem CID 117063408) has the molecular formula C9H8Cl2O3S and a molecular weight of 267.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-3-methylsulfonyloxirane.
| Compound Name | 2-(2,4-dichlorophenyl)-3-methylsulfonyloxirane |
|---|---|
| PubChem CID | 117063408 |
| Molecular Formula | C9H8Cl2O3S |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 265.96 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-3-methylsulfonyloxirane |
| SMILES | CS(=O)(=O)C1OC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl2O3S/c1-15(12,13)9-8(14-9)6-3-2-5(10)4-7(6)11/h2-4,8-9H,1H3 |
| InChIKey | MWQOZELTSIPSCW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|