C14H13Cl2N3OS — CID 135701981
(4R,6R)-4-(2,3-dichlorophenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one (PubChem CID 135701981) has the molecular formula C14H13Cl2N3OS and a molecular weight of 342.25 g/mol. Its IUPAC name is (4R,6R)-4-(2,3-dichlorophenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one.
| Compound Name | (4R,6R)-4-(2,3-dichlorophenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135701981 |
| Molecular Formula | C14H13Cl2N3OS |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | (4R,6R)-4-(2,3-dichlorophenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
| SMILES | Cc1[nH]nc2c1[C@H](c1cccc(Cl)c1Cl)S[C@H](C)C(=O)N2 |
| InChI | InChI=1S/C14H13Cl2N3OS/c1-6-10-12(8-4-3-5-9(15)11(8)16)21-7(2)14(20)17-13(10)19-18-6/h3-5,7,12H,1-2H3,(H2,17,18,19,20)/t7-,12+/m1/s1 |
| InChIKey | CAYCNNAUTLTMPL-KRTXAFLBSA-N |
| XLogP | 4.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |