C16H19N3O3S — CID 135701643
(4S,6S)-4-(3-ethoxy-4-hydroxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one (PubChem CID 135701643) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is (4S,6S)-4-(3-ethoxy-4-hydroxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one.
| Compound Name | (4S,6S)-4-(3-ethoxy-4-hydroxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135701643 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | (4S,6S)-4-(3-ethoxy-4-hydroxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
| SMILES | CCOc1cc([C@@H]2S[C@@H](C)C(=O)Nc3n[nH]c(C)c32)ccc1O |
| InChI | InChI=1S/C16H19N3O3S/c1-4-22-12-7-10(5-6-11(12)20)14-13-8(2)18-19-15(13)17-16(21)9(3)23-14/h5-7,9,14,20H,4H2,1-3H3,(H2,17,18,19,21)/t9-,14-/m0/s1 |
| InChIKey | SVANCIKOOLOQEK-XPTSAGLGSA-N |
| XLogP | 2.99 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |