C16H19N3O4S — CID 135505479
4-(4-hydroxy-3,5-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one (PubChem CID 135505479) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 4-(4-hydroxy-3,5-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one.
| Compound Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
|---|---|
| PubChem CID | 135505479 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)-3,6-dimethyl-4,8-dihydro-2H-pyrazolo[3,4-e][1,4]thiazepin-7-one |
| SMILES | COc1cc(C2SC(C)C(=O)Nc3n[nH]c(C)c32)cc(OC)c1O |
| InChI | InChI=1S/C16H19N3O4S/c1-7-12-14(24-8(2)16(21)17-15(12)19-18-7)9-5-10(22-3)13(20)11(6-9)23-4/h5-6,8,14,20H,1-4H3,(H2,17,18,19,21) |
| InChIKey | VFECBSLNPGLZHP-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |